cas: 1093757-42-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
VU0155041, 99.10% (CAS 1093757-42-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 mg, 100 mg, 50 mg, 25 mg, 10mM/1mL, 10 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-14417-5 mg |
| cas | 1093757-42-6 |
| opakowanie | 5 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 mg | 649,42 Pln | |
| MedChemExpress | 100 mg | 3189,68 Pln | |
| MedChemExpress | 50 mg | 2135,50 Pln | |
| MedChemExpress | 25 mg | 1559,64 Pln | |
| MedChemExpress | 10mM/1mL | 700,50 Pln | |
| MedChemExpress | 10 mg | 886,26 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.10% |
Cis-(1R,2S)-2-[(3,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid (CAS 1093757-42-6) to związek chemiczny o wzorze sumarycznym C14H15Cl2NO3 i masie molowej 316.2 g/mol. Nazwa systematyczna IUPAC: cis-(1R,2S)-2-[(3,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid. InChIKey: VSMUYYFJVFSVCA-NWDGAFQWSA-N.
| Wzór sumaryczny | C14H15Cl2NO3 |
|---|---|
| Masa molowa | 316.2 g/mol |
| Nazwa IUPAC | cis-(1R,2S)-2-[(3,5-dichlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| InChIKey | VSMUYYFJVFSVCA-NWDGAFQWSA-N |
| SMILES | C1CC[C@H]([C@H](C1)C(=O)NC2=CC(=CC(=C2)Cl)Cl)C(=O)O |
Dane obliczone przez PubChem (NCBI)