cas: 3098-92-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Vinyl 3-phenylacrylate, 98% +(stabilized with TBC), 98% +(stabilized with TBC) (CAS 3098-92-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 25mg, 50mg, 100mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1142TH-5mg |
| cas | 3098-92-8 |
| opakowanie | 5mg |
| dostępność | 0.3g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 5mg | 203,60 Pln | |
| Chemat | 10mg | 266,00 Pln | |
| Chemat | 25mg | 386,00 Pln | |
| Chemat | 50mg | 525,20 Pln | |
| Chemat | 100mg | 746,00 Pln |
| czystość | 98% +(stabilized with TBC) |
|---|---|
| czas dostawy | 3 tygodnie |
Ethenyl (E)-3-phenylprop-2-enoate (CAS 3098-92-8) to związek chemiczny o wzorze sumarycznym C11H10O2 i masie molowej 174.20 g/mol. Nazwa systematyczna IUPAC: ethenyl (E)-3-phenylprop-2-enoate. InChIKey: WGXGKXTZIQFQFO-CMDGGOBGSA-N.
| Wzór sumaryczny | C11H10O2 |
|---|---|
| Masa molowa | 174.20 g/mol |
| Nazwa IUPAC | ethenyl (E)-3-phenylprop-2-enoate |
| InChIKey | WGXGKXTZIQFQFO-CMDGGOBGSA-N |
| SMILES | C=COC(=O)/C=C/C1=CC=CC=C1 |
Dane obliczone przez PubChem (NCBI)