Vitamin K, 98%+,RG
cas: 12001-79-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Vitamin K, 98%+,RG (CAS 12001-79-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119S17-25mg |
| cas | 12001-79-5 |
| opakowanie | 25mg |
| dostępność | 200g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 25mg | 290,00 Pln | |
| Chemat | 50mg | 386,00 Pln | |
| Chemat | 100mg | 626,00 Pln | |
| Chemat | 250mg | 798,80 Pln | |
| Chemat | 500mg | 1509,20 Pln | |
| Chemat | 1g | 2790,80 Pln | |
| Chemat | 5g | 7446,80 Pln | |
| Chemat | 25g | 35507,60 Pln |
właściwości
| czystość | 98%+,RG |
|---|---|
| czas dostawy | 3 tygodnie |
2-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione (CAS 12001-79-5) to związek chemiczny o wzorze sumarycznym C31H46O2 i masie molowej 450.7 g/mol. Nazwa systematyczna IUPAC: 2-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione. InChIKey: MBWXNTAXLNYFJB-LKUDQCMESA-N.
| Wzór sumaryczny | C31H46O2 |
|---|---|
| Masa molowa | 450.7 g/mol |
| Nazwa IUPAC | 2-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione |
| InChIKey | MBWXNTAXLNYFJB-LKUDQCMESA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CCCC(C)CCCC(C)CCCC(C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
VITAMIN K, 2-methyl-3-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione, .alpha.-Phylloquinone, Phythyl-menadion, 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-en-1-yl)naphthalene-1,4-dione, 3-methyl-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione, (E)-2-Methyl-3-(3,7,11,15-tetramethylhexadec-2-en-1-yl)naphthalene-1,4-dione, (E)-2-Methyl-3-(3,7,11,15-tetramethylhexadec-2-en-1-yl)naphthalene-1,4-dione1, 3-((2E)-3,7,11,15-tetramethylhexadec-2-enyl)-2-methylnaphthalene-1,4-dione, 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)naphthalene-1,4-dione