cas: 84-80-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Vitamin K1, 98.60% (CAS 84-80-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 g, 1 g, 10mM/1mL, 10 g, 500 mg, 5 g, 100 g, 50 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-N0684-25 g |
| cas | 84-80-0 |
| opakowanie | 25 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 g | 1801,13 Pln | |
| MedChemExpress | 1 g | 333,62 Pln | |
| MedChemExpress | 10mM/1mL | 277,90 Pln | |
| MedChemExpress | 10 g | 1174,19 Pln | |
| MedChemExpress | 500 mg | 263,96 Pln | |
| MedChemExpress | 5 g | 719,08 Pln | |
| MedChemExpress | 100 g | 3621,58 Pln | |
| MedChemExpress | 50 g | 2613,83 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.60% |
2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione (CAS 84-80-0) to związek chemiczny o wzorze sumarycznym C31H46O2 i masie molowej 450.7 g/mol. Nazwa systematyczna IUPAC: 2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione. InChIKey: MBWXNTAXLNYFJB-NKFFZRIASA-N.
| Wzór sumaryczny | C31H46O2 |
|---|---|
| Masa molowa | 450.7 g/mol |
| Nazwa IUPAC | 2-methyl-3-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione |
| InChIKey | MBWXNTAXLNYFJB-NKFFZRIASA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
Dane obliczone przez PubChem (NCBI)