cas: 960203-27-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Vortioxetine (hydrobromide), 99.87% (CAS 960203-27-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 500 mg, 10 mg, 1 g, 5 mg, 200 mg, 50 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15414A-10mM/1mL |
| cas | 960203-27-4 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 412,57 Pln | |
| MedChemExpress | 500 mg | 2493,08 Pln | |
| MedChemExpress | 10 mg | 384,71 Pln | |
| MedChemExpress | 1 g | 3551,92 Pln | |
| MedChemExpress | 5 mg | 287,18 Pln | |
| MedChemExpress | 200 mg | 1438,90 Pln | |
| MedChemExpress | 50 mg | 700,50 Pln | |
| MedChemExpress | 100 mg | 909,48 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.87% |
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide (CAS 960203-27-4) to związek chemiczny o wzorze sumarycznym C18H23BrN2S i masie molowej 379.4 g/mol. Nazwa systematyczna IUPAC: 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide. InChIKey: VNGRUFUIHGGOOM-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H23BrN2S |
|---|---|
| Masa molowa | 379.4 g/mol |
| Nazwa IUPAC | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;hydrobromide |
| InChIKey | VNGRUFUIHGGOOM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=CC=C2N3CCNCC3)C.Br |
Dane obliczone przez PubChem (NCBI)