cas: 796854-35-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
WAY-204688, 99.89% (CAS 796854-35-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 5 mg, 100 mg, 10 mg, 50 mg, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-19498-10mM/1mL |
| cas | 796854-35-8 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 2822,81 Pln | |
| MedChemExpress | 5 mg | 2325,90 Pln | |
| MedChemExpress | 100 mg | 18352,34 Pln | |
| MedChemExpress | 10 mg | 3668,02 Pln | |
| MedChemExpress | 50 mg | 11516,38 Pln | |
| MedChemExpress | 25 mg | 7220,68 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.89% |
(2S)-2-[(S)-(2-methoxyphenyl)-naphthalen-1-ylmethyl]-2-methyl-3-oxo-3-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]propanenitrile (CAS 796854-35-8) to związek chemiczny o wzorze sumarycznym C34H31F3N2O2 i masie molowej 556.6 g/mol. Nazwa systematyczna IUPAC: (2S)-2-[(S)-(2-methoxyphenyl)-naphthalen-1-ylmethyl]-2-methyl-3-oxo-3-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]propanenitrile. InChIKey: JZPONCMNBSEYQW-CQTOTRCISA-N.
| Wzór sumaryczny | C34H31F3N2O2 |
|---|---|
| Masa molowa | 556.6 g/mol |
| Nazwa IUPAC | (2S)-2-[(S)-(2-methoxyphenyl)-naphthalen-1-ylmethyl]-2-methyl-3-oxo-3-[4-[3-(trifluoromethyl)phenyl]piperidin-1-yl]propanenitrile |
| InChIKey | JZPONCMNBSEYQW-CQTOTRCISA-N |
| SMILES | C[C@@](C#N)([C@H](C1=CC=CC=C1OC)C2=CC=CC3=CC=CC=C32)C(=O)N4CCC(CC4)C5=CC(=CC=C5)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)