cas: 284028-89-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
XAV-939, 99.91% (CAS 284028-89-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 10mM/1mL, 1 g, 10 mg, 500 mg, 5 mg, 50 mg, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15147-100 mg |
| cas | 284028-89-3 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 1731,47 Pln | |
| MedChemExpress | 10mM/1mL | 435,79 Pln | |
| MedChemExpress | 1 g | 6835,22 Pln | |
| MedChemExpress | 10 mg | 463,66 Pln | |
| MedChemExpress | 500 mg | 4917,25 Pln | |
| MedChemExpress | 5 mg | 407,93 Pln | |
| MedChemExpress | 50 mg | 1155,61 Pln | |
| MedChemExpress | 25 mg | 811,96 Pln | |
| MedChemExpress | 200 mg | 2999,28 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.91% |
2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one (CAS 284028-89-3) to związek chemiczny o wzorze sumarycznym C14H11F3N2OS i masie molowej 312.31 g/mol. Nazwa systematyczna IUPAC: 2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one. InChIKey: KLGQSVMIPOVQAX-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H11F3N2OS |
|---|---|
| Masa molowa | 312.31 g/mol |
| Nazwa IUPAC | 2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
| InChIKey | KLGQSVMIPOVQAX-UHFFFAOYSA-N |
| SMILES | C1CSCC2=C1N=C(NC2=O)C3=CC=C(C=C3)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)