cas: 146986-50-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Y-27632, 99.91% (CAS 146986-50-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 mg, 25 mg, 10 mg, 5 mg, 500 mg, 200 mg, 1 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-10071-50 mg |
| cas | 146986-50-7 |
| opakowanie | 50 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 mg | 960,56 Pln | |
| MedChemExpress | 25 mg | 598,33 Pln | |
| MedChemExpress | 10 mg | 454,37 Pln | |
| MedChemExpress | 5 mg | 361,49 Pln | |
| MedChemExpress | 500 mg | 4870,81 Pln | |
| MedChemExpress | 200 mg | 2279,46 Pln | |
| MedChemExpress | 1 mg | 263,96 Pln | |
| MedChemExpress | 10mM/1mL | 514,74 Pln | |
| MedChemExpress | 100 mg | 1559,64 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.91% |
4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide (CAS 146986-50-7) to związek chemiczny o wzorze sumarycznym C14H21N3O i masie molowej 247.34 g/mol. Nazwa systematyczna IUPAC: 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide. InChIKey: IYOZTVGMEWJPKR-VOMCLLRMSA-N.
| Wzór sumaryczny | C14H21N3O |
|---|---|
| Masa molowa | 247.34 g/mol |
| Nazwa IUPAC | 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide |
| InChIKey | IYOZTVGMEWJPKR-VOMCLLRMSA-N |
| SMILES | C[C@H](C1CCC(CC1)C(=O)NC2=CC=NC=C2)N |
Dane obliczone przez PubChem (NCBI)