cas: 2407654-51-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
ZXH-1-161, 98.92% (CAS 2407654-51-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5 mg, 10mM/1mL, 10 mg, 25 mg, 100 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-147158-5 mg |
| cas | 2407654-51-5 |
| opakowanie | 5 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 5 mg | 1318,15 Pln | |
| MedChemExpress | 10mM/1mL | 1438,90 Pln | |
| MedChemExpress | 10 mg | 1945,09 Pln | |
| MedChemExpress | 25 mg | 3719,10 Pln | |
| MedChemExpress | 100 mg | 8757,84 Pln | |
| MedChemExpress | 50 mg | 5878,56 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.92% |
3-[7-[[2-(2,3-dihydro-1H-inden-5-ylamino)pyrimidin-4-yl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2407654-51-5) to związek chemiczny o wzorze sumarycznym C26H24N6O3 i masie molowej 468.5 g/mol. Nazwa systematyczna IUPAC: 3-[7-[[2-(2,3-dihydro-1H-inden-5-ylamino)pyrimidin-4-yl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: KCIIVRZRNLZKQA-UHFFFAOYSA-N.
| Wzór sumaryczny | C26H24N6O3 |
|---|---|
| Masa molowa | 468.5 g/mol |
| Nazwa IUPAC | 3-[7-[[2-(2,3-dihydro-1H-inden-5-ylamino)pyrimidin-4-yl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | KCIIVRZRNLZKQA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NC3=NC=CC(=N3)NC4=CC=CC5=C4CN(C5=O)C6CCC(=O)NC6=O |
Dane obliczone przez PubChem (NCBI)