cas: 7619-53-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Zuclomiphene (citrate), 98.09% (CAS 7619-53-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 10 mg, 50 mg, 100 mg, 5 mg, 25 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-B1617A-10mM/1mL |
| cas | 7619-53-6 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 1285,64 Pln | |
| MedChemExpress | 10 mg | 1536,42 Pln | |
| MedChemExpress | 50 mg | 4582,88 Pln | |
| MedChemExpress | 100 mg | 7267,12 Pln | |
| MedChemExpress | 5 mg | 1007,00 Pln | |
| MedChemExpress | 25 mg | 2911,04 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.09% |
2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 7619-53-6) to związek chemiczny o wzorze sumarycznym C32H36ClNO8 i masie molowej 598.1 g/mol. Nazwa systematyczna IUPAC: 2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: PYTMYKVIJXPNBD-OQKDUQJOSA-N.
| Wzór sumaryczny | C32H36ClNO8 |
|---|---|
| Masa molowa | 598.1 g/mol |
| Nazwa IUPAC | 2-[4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | PYTMYKVIJXPNBD-OQKDUQJOSA-N |
| SMILES | CCN(CC)CCOC1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)\Cl)/C3=CC=CC=C3.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Dane obliczone przez PubChem (NCBI)