cas: 1186025-29-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
alpha-[3-(1,1-Dimethylethoxy)-3-oxopropyl]-omega-hydroxypoly(oxy-1,2-ethanediyl), 95%, 95% (CAS 1186025-29-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11022R-100mg |
| cas | 1186025-29-5 |
| opakowanie | 100mg |
| dostępność | 15g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 414,80 Pln | |
| Chemat | 250mg | 942,80 Pln | |
| Chemat | 500mg | 1566,80 Pln | |
| Chemat | 1g | 2416,40 Pln | |
| Chemat | 5g | 8834,00 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1186025-29-5) to związek chemiczny o wzorze sumarycznym C55H110O27 i masie molowej 1203.4 g/mol. Nazwa systematyczna IUPAC: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: YMILISGQCISYOH-UHFFFAOYSA-N.
| Wzór sumaryczny | C55H110O27 |
|---|---|
| Masa molowa | 1203.4 g/mol |
| Nazwa IUPAC | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | YMILISGQCISYOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
Dane obliczone przez PubChem (NCBI)