cis-Methyl 5-(4-(trifluoromethyl)phenyl)tetrahydrofuran-2-carboxylate, 97%
cas: 2828433-39-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
cis-Methyl 5-(4-(trifluoromethyl)phenyl)tetrahydrofuran-2-carboxylate, 97% (CAS 2828433-39-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A1375929-250mg |
| cas | 2828433-39-0 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 320,31 Pln | |
| Ambeed | 1g | 737,50 Pln | |
| Ambeed | 5g | 2411,81 Pln | |
| Chemat | 100mg | 222,80 Pln | |
| Chemat | 250mg | 333,20 Pln | |
| Chemat | 1g | 818,00 Pln | |
| Chemat | 5g | 3822,80 Pln | |
| BLDpharm | 100mg | 219,95 Pln | |
| BLDpharm | 250mg | 314,36 Pln | |
| BLDpharm | 1g | 725,32 Pln | |
| BLDpharm | 5g | 2369,19 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate (CAS 2828433-39-0) to związek chemiczny o wzorze sumarycznym C13H13F3O3 i masie molowej 274.23 g/mol. Nazwa systematyczna IUPAC: methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate. InChIKey: MJPNDBIPJQNUCT-MNOVXSKESA-N.
| Wzór sumaryczny | C13H13F3O3 |
|---|---|
| Masa molowa | 274.23 g/mol |
| Nazwa IUPAC | methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate |
| InChIKey | MJPNDBIPJQNUCT-MNOVXSKESA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H](O1)C2=CC=C(C=C2)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
cis-Methyl 5-(4-(trifluoromethyl)phenyl)tetrahydrofuran-2-carboxylate, rac-methyl (2r,5s)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate, methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate, (2S,5R)-Methyl 5-(4-(trifluoromethyl)phenyl)tetrahydrofuran-2-carboxylate, rac-methyl (2R,5S)-5-[4-(trifluoromethyl)phenyl]oxolane-2-carboxylate, cis, methyl (2S,5R)-5-[4-(trifluoromethyl)phenyl]tetrahydrofuran-2-carboxylate