cis-Resveratrol 95%
cas: 61434-67-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
cis-Resveratrol 95% (CAS 61434-67-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 50mg. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A426095-5mg |
| cas | 61434-67-1 |
| opakowanie | 5mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 5mg | 420,44 Pln | |
| Ambeed | 10mg | 681,88 Pln | |
| Ambeed | 50mg | 2417,38 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A426095 |
5-[(Z)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol (CAS 61434-67-1) to związek chemiczny o wzorze sumarycznym C14H12O3 i masie molowej 228.24 g/mol. Nazwa systematyczna IUPAC: 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol. InChIKey: LUKBXSAWLPMMSZ-UPHRSURJSA-N.
| Wzór sumaryczny | C14H12O3 |
|---|---|
| Masa molowa | 228.24 g/mol |
| Nazwa IUPAC | 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| InChIKey | LUKBXSAWLPMMSZ-UPHRSURJSA-N |
| SMILES | C1=CC(=CC=C1/C=C\C2=CC(=CC(=C2)O)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
cis-resveratrol, (Z)-resveratrol, Resveratrol, (Z)-, 5-[(Z)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol, 5-((Z)-2-(4-hydroxyphenyl)ethenyl)benzene-1,3-diol, Resveratrol (Z)-, (Z)-3,5,4'-trihydroxystilbene, cis-3,4',5-trihydroxystilbene, 5-[(Z)-2-(4-hydroxyphenyl)vinyl]benzene-1,3-diol, Z-Resveratrol