cis-tert-Butyl 4-hydroxycyclohexane-1-carboxylate, 97%
cas: 931110-79-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
cis-tert-Butyl 4-hydroxycyclohexane-1-carboxylate, 97% (CAS 931110-79-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 500mg. Oferty producentów: Ambeed, BLDpharm, Chemat.
| producent | Ambeed |
|---|---|
| nr katalogowy | A712993-100mg |
| cas | 931110-79-1 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 359,25 Pln | |
| Ambeed | 250mg | 565,06 Pln | |
| Ambeed | 1g | 1299,31 Pln | |
| Ambeed | 5g | 4436,56 Pln | |
| Ambeed | 10g | 7056,50 Pln | |
| BLDpharm | 100mg | 386,56 Pln | |
| BLDpharm | 250mg | 608,70 Pln | |
| BLDpharm | 1g | 1391,76 Pln | |
| BLDpharm | 5g | 4779,45 Pln | |
| BLDpharm | 10g | 7600,68 Pln | |
| Chemat | 100mg | 213,20 Pln | |
| Chemat | 250mg | 376,40 Pln | |
| Chemat | 500mg | 635,60 Pln | |
| Chemat | 1g | 813,20 Pln | |
| Chemat | 5g | 3174,80 Pln | |
| Chemat | 10g | 5742,80 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 2-3 tygodnie |
Tert-butyl 4-hydroxycyclohexane-1-carboxylate (CAS 931110-79-1) to związek chemiczny o wzorze sumarycznym C11H20O3 i masie molowej 200.27 g/mol. Nazwa systematyczna IUPAC: tert-butyl 4-hydroxycyclohexane-1-carboxylate. InChIKey: MVSANBPTBLEQMT-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H20O3 |
|---|---|
| Masa molowa | 200.27 g/mol |
| Nazwa IUPAC | tert-butyl 4-hydroxycyclohexane-1-carboxylate |
| InChIKey | MVSANBPTBLEQMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCC(CC1)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
trans-tert-Butyl 4-hydroxycyclohexanecarboxylate, tert-Butyl 4-hydroxycyclohexanecarboxylate, cis-tert-Butyl 4-hydroxycyclohexane-1-carboxylate, tert-butyl trans-4-hydroxycyclohexanecarboxylate, tert-Butyl (1r,4r)-4-hydroxycyclohexane-1-carboxylate, trans-4-Hydroxy-cyclohexane-carboxylic acid tert-butyl ester, trans-4-hydroxycyclohexanecarboxylic acid tert-butyl ester, cis-tert-Butyl-4-hydroxycyclohexane-1-carboxylate, tert-butyl cis-4-hydroxycyclohexane-1-carboxylate, tert-butyl (1s,4s)-4-hydroxycyclohexane-1-carboxylate