dimethyl thiophene-2,5-dicarboxylate, 98%
cas: 4282-34-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
dimethyl thiophene-2,5-dicarboxylate, 98% (CAS 4282-34-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg, 10g. Oferty producentów: Fluorochem, Ambeed, Chemat.
| producent | Fluorochem |
|---|---|
| nr katalogowy | F373904-250MG |
| cas | 4282-34-2 |
| opakowanie | 250mg |
| dostępność | In Stock China |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Fluorochem | 250mg | 263,47 Pln | |
| Fluorochem | 1g | 476,93 Pln | |
| Fluorochem | 5g | 1674,43 Pln | |
| Ambeed | 100mg | 197,94 Pln | |
| Ambeed | 250mg | 281,38 Pln | |
| Ambeed | 1g | 620,69 Pln | |
| Ambeed | 5g | 2161,50 Pln | |
| Chemat | 100mg | 155,60 Pln | |
| Chemat | 250mg | 218,00 Pln | |
| Chemat | 1g | 458,00 Pln | |
| Chemat | 5g | 1590,80 Pln | |
| Chemat | 10g | 2992,40 Pln |
właściwości
| czystość | 98% |
|---|---|
| podwójne zastosowanie | No |
| waluta | EUR |
| czas dostawy | 2-3 tygodnie |
| kategoria | Odczynniki chemiczne |
Dimethyl thiophene-2,5-dicarboxylate (CAS 4282-34-2) to związek chemiczny o wzorze sumarycznym C8H8O4S i masie molowej 200.21 g/mol. Nazwa systematyczna IUPAC: dimethyl thiophene-2,5-dicarboxylate. InChIKey: CYUGNCLRGFKPAE-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H8O4S |
|---|---|
| Masa molowa | 200.21 g/mol |
| Nazwa IUPAC | dimethyl thiophene-2,5-dicarboxylate |
| InChIKey | CYUGNCLRGFKPAE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(S1)C(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,5-Thiophenedicarboxylic acid, 2,5-dimethyl ester, dimethyl thiophene-2,5-dicarboxylate, 2,5-Thiophenedicarboxylic acid dimethyl ester, 2,5-dimethyl thiophene-2,5-dicarboxylate, Dimethyl 2,5-thiophenedicarboxylate, thiophene-2,5-dicarboxylic acid dimethyl ester, 2,5-thiophenedicarboxylic acid, dimethyl ester, methyl 5-(methoxycarbonyl)thiophene-2-carboxylate, 2,5-Thiophenedicarboxylicacid, 2,5-dimethyl ester, Dimethyl thiophene-25-dicarboxylate