cas: 1934259-00-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
limertinib, 99.12% (CAS 1934259-00-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 mg, 10 mg, 25 mg, 100 mg, 10mM/1mL, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-138751-50 mg |
| cas | 1934259-00-3 |
| opakowanie | 50 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 mg | 3421,88 Pln | |
| MedChemExpress | 10 mg | 1341,37 Pln | |
| MedChemExpress | 25 mg | 2321,26 Pln | |
| MedChemExpress | 100 mg | 5070,50 Pln | |
| MedChemExpress | 10mM/1mL | 1099,88 Pln | |
| MedChemExpress | 5 mg | 937,34 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.12% |
N-[5-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide (CAS 1934259-00-3) to związek chemiczny o wzorze sumarycznym C29H32ClN7O2 i masie molowej 546.1 g/mol. Nazwa systematyczna IUPAC: N-[5-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide. InChIKey: QHPVTCLSVVUPOF-UHFFFAOYSA-N.
| Wzór sumaryczny | C29H32ClN7O2 |
|---|---|
| Masa molowa | 546.1 g/mol |
| Nazwa IUPAC | N-[5-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
| InChIKey | QHPVTCLSVVUPOF-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(C)C1=CC(=C(C=C1NC(=O)C=C)NC2=NC=C(C(=N2)NC3=CC4=CC=CC=C4C=C3)Cl)OC |
Dane obliczone przez PubChem (NCBI)