cas: 2719793-90-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
lunresertib, 99.97% (CAS 2719793-90-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 1 mg, 25 mg, 5 mg, 10 mg, 100 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-145817A-10mM/1mL |
| cas | 2719793-90-3 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 3811,98 Pln | |
| MedChemExpress | 1 mg | 1462,12 Pln | |
| MedChemExpress | 25 mg | 7699,01 Pln | |
| MedChemExpress | 5 mg | 3477,61 Pln | |
| MedChemExpress | 10 mg | 5493,11 Pln | |
| MedChemExpress | 100 mg | 12835,27 Pln | |
| MedChemExpress | 50 mg | 9955,99 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.97% |
2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide (CAS 2719793-90-3) to związek chemiczny o wzorze sumarycznym C18H20N4O2 i masie molowej 324.4 g/mol. Nazwa systematyczna IUPAC: 2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide. InChIKey: ARBRHWRTXPWZGN-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H20N4O2 |
|---|---|
| Masa molowa | 324.4 g/mol |
| Nazwa IUPAC | 2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide |
| InChIKey | ARBRHWRTXPWZGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)C)N2C(=C(C3=C2N=C(C(=C3)C)C)C(=O)N)N |
Dane obliczone przez PubChem (NCBI)