cas: 2823368-12-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
m-PEG25-acid, 95% (CAS 2823368-12-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 1g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A755765-50mg |
| cas | 2823368-12-1 |
| opakowanie | 50mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 50mg | 876,56 Pln | |
| Ambeed | 100mg | 1460,62 Pln | |
| Ambeed | 1g | 6033,00 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2823368-12-1) to związek chemiczny o wzorze sumarycznym C52H104O27 i masie molowej 1161.4 g/mol. Nazwa systematyczna IUPAC: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RKDVSVRODIIQGU-UHFFFAOYSA-N.
| Wzór sumaryczny | C52H104O27 |
|---|---|
| Masa molowa | 1161.4 g/mol |
| Nazwa IUPAC | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RKDVSVRODIIQGU-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Dane obliczone przez PubChem (NCBI)