CAS 143499-84-7 to numer rejestracyjny substancji 5-Ethenyl-2,2′:5′,2′′-terthiophene, 95%, 95%. Oferty producentów: Chemat. Dostępne opakowania: 50mg, 100mg.
2-ethenyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene (CAS 143499-84-7) to związek chemiczny o wzorze sumarycznym C14H10S3 i masie molowej 274.4 g/mol. Nazwa systematyczna IUPAC: 2-ethenyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene. InChIKey: ADTORIPCMAXQFV-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H10S3 |
|---|---|
| Masa molowa | 274.4 g/mol |
| Nazwa IUPAC | 2-ethenyl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene |
| InChIKey | ADTORIPCMAXQFV-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(S1)C2=CC=C(S2)C3=CC=CS3 |
Dane obliczone przez PubChem (NCBI)