cas: 1174020-43-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate, 98%, 98% (CAS 1174020-43-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g, 10g, 50g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch111E9F-100mg |
| cas | 1174020-43-9 |
| opakowanie | 100mg |
| dostępność | 500g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 146,00 Pln | |
| Chemat | 250mg | 198,80 Pln | |
| Chemat | 500mg | 290,00 Pln | |
| Chemat | 1g | 405,20 Pln | |
| Chemat | 5g | 1096,40 Pln | |
| Chemat | 10g | 1782,80 Pln | |
| Chemat | 50g | 5435,60 Pln | |
| Chemat | 25g | 2958,80 Pln | |
| Chemat | 100g | 10389,20 Pln | |
| Chemat | 250g | 14819,60 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate (CAS 1174020-43-9) to związek chemiczny o wzorze sumarycznym C10H18FNO3 i masie molowej 219.25 g/mol. Nazwa systematyczna IUPAC: tert-butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate. InChIKey: XRNLYXKYODGLMI-HTQZYQBOSA-N.
| Wzór sumaryczny | C10H18FNO3 |
|---|---|
| Masa molowa | 219.25 g/mol |
| Nazwa IUPAC | tert-butyl (3R,4R)-3-fluoro-4-hydroxypiperidine-1-carboxylate |
| InChIKey | XRNLYXKYODGLMI-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)F)O |
Dane obliczone przez PubChem (NCBI)