cas: 2821795-85-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl (R)-(2-hydroxy-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethyl)carbamate, 97%, 97% (CAS 2821795-85-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1F2C0Q-50mg |
| cas | 2821795-85-9 |
| opakowanie | 50mg |
| dostępność | 2g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 304,40 Pln | |
| Chemat | 100mg | 462,80 Pln | |
| Chemat | 250mg | 731,60 Pln | |
| Chemat | 1g | 1739,60 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl N-[(1R)-2-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate (CAS 2821795-85-9) to związek chemiczny o wzorze sumarycznym C19H30BNO5 i masie molowej 363.3 g/mol. Nazwa systematyczna IUPAC: tert-butyl N-[(1R)-2-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate. InChIKey: PXMBGSVWWPGOCQ-HNNXBMFYSA-N.
| Wzór sumaryczny | C19H30BNO5 |
|---|---|
| Masa molowa | 363.3 g/mol |
| Nazwa IUPAC | tert-butyl N-[(1R)-2-hydroxy-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]carbamate |
| InChIKey | PXMBGSVWWPGOCQ-HNNXBMFYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)[C@H](CO)NC(=O)OC(C)(C)C |
Dane obliczone przez PubChem (NCBI)