tert-Butyl 2-(4-(bromomethyl)phenyl)acetate, 97%
cas: 77292-91-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl 2-(4-(bromomethyl)phenyl)acetate, 97% (CAS 77292-91-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A548300-250mg |
| cas | 77292-91-2 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 381,50 Pln | |
| Ambeed | 1g | 915,50 Pln | |
| Ambeed | 5g | 3029,25 Pln | |
| Chemat | 250mg | 381,20 Pln | |
| Chemat | 1g | 923,60 Pln | |
| Chemat | 5g | 3074,00 Pln | |
| BLDpharm | 250mg | 408,77 Pln | |
| BLDpharm | 1g | 980,79 Pln | |
| BLDpharm | 5g | 3257,77 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 2-3 tygodnie |
Tert-butyl 2-[4-(bromomethyl)phenyl]acetate (CAS 77292-91-2) to związek chemiczny o wzorze sumarycznym C13H17BrO2 i masie molowej 285.18 g/mol. Nazwa systematyczna IUPAC: tert-butyl 2-[4-(bromomethyl)phenyl]acetate. InChIKey: RSSSPVYGYNGCSG-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H17BrO2 |
|---|---|
| Masa molowa | 285.18 g/mol |
| Nazwa IUPAC | tert-butyl 2-[4-(bromomethyl)phenyl]acetate |
| InChIKey | RSSSPVYGYNGCSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC=C(C=C1)CBr |
Dane obliczone przez PubChem (NCBI)
Synonimy:
tert-butyl 2-(4-(bromomethyl)phenyl)acetate, tert-butyl 2-[4-(bromomethyl)phenyl]acetate, alpha-(4-broMoMethylphenyl)acetic acid tert-butyl ester, tert-Butyl 4-(Bromomethyl)phenylacetate, tert-butyl2-(4-(bromomethyl)phenyl)acetate, tert-Butyl 2-(4-(bromomethy l)phenyl)acetate, ?-(4-broMoMethylphenyl)acetic acid tert-butyl ester, |A-(4-broMoMethylphenyl)acetic acid tert-butyl ester, 4-(Bromomethyl)benzeneacetic acid 1,1-dimethylethyl ester, Benzeneacetic acid, 4-(bromomethyl)-, 1,1-dimethylethyl ester