cas: 2376764-71-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl 3-((4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylene)pyrrolidine-1-carboxylate, 97%, 97% (CAS 2376764-71-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12WTTY-100mg |
| cas | 2376764-71-3 |
| opakowanie | 100mg |
| dostępność | 150g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 198,80 Pln | |
| Chemat | 250mg | 290,00 Pln | |
| Chemat | 1g | 731,60 Pln | |
| Chemat | 5g | 2210,00 Pln | |
| Chemat | 25g | 7278,80 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl (3Z)-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pyrrolidine-1-carboxylate (CAS 2376764-71-3) to związek chemiczny o wzorze sumarycznym C16H28BNO4 i masie molowej 309.2 g/mol. Nazwa systematyczna IUPAC: tert-butyl (3Z)-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pyrrolidine-1-carboxylate. InChIKey: CPKMTYPRYKIRQC-BENRWUELSA-N.
| Wzór sumaryczny | C16H28BNO4 |
|---|---|
| Masa molowa | 309.2 g/mol |
| Nazwa IUPAC | tert-butyl (3Z)-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pyrrolidine-1-carboxylate |
| InChIKey | CPKMTYPRYKIRQC-BENRWUELSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C\2/CCN(C2)C(=O)OC(C)(C)C |
Dane obliczone przez PubChem (NCBI)