cas: 1105662-87-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl 3-(2-methoxy-2-oxoethylidene)azetidine-1-carboxylate, 96%, 96% (CAS 1105662-87-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119TAQ-100mg |
| cas | 1105662-87-0 |
| opakowanie | 100mg |
| dostępność | 200g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 83,60 Pln | |
| Chemat | 250mg | 83,60 Pln | |
| Chemat | 1g | 117,20 Pln | |
| Chemat | 5g | 227,60 Pln | |
| Chemat | 10g | 362,00 Pln | |
| Chemat | 25g | 664,40 Pln | |
| Chemat | 100g | 2253,20 Pln |
| czystość | 96% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl 3-(2-methoxy-2-oxoethylidene)azetidine-1-carboxylate (CAS 1105662-87-0) to związek chemiczny o wzorze sumarycznym C11H17NO4 i masie molowej 227.26 g/mol. Nazwa systematyczna IUPAC: tert-butyl 3-(2-methoxy-2-oxoethylidene)azetidine-1-carboxylate. InChIKey: DHTIDVBYPXKXSK-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H17NO4 |
|---|---|
| Masa molowa | 227.26 g/mol |
| Nazwa IUPAC | tert-butyl 3-(2-methoxy-2-oxoethylidene)azetidine-1-carboxylate |
| InChIKey | DHTIDVBYPXKXSK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=CC(=O)OC)C1 |
Dane obliczone przez PubChem (NCBI)