tert-Butyl 3-fluoro-3-(((methylsulfonyl)oxy)methyl)azetidine-1-carboxylate, 97%
cas: 1466514-75-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl 3-fluoro-3-(((methylsulfonyl)oxy)methyl)azetidine-1-carboxylate, 97% (CAS 1466514-75-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 50mg, 100mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A564506-250mg |
| cas | 1466514-75-9 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 2295,00 Pln | |
| Ambeed | 1g | 6077,50 Pln | |
| Chemat | 50mg | 774,80 Pln | |
| Chemat | 100mg | 1274,00 Pln | |
| Chemat | 250mg | 2118,80 Pln | |
| Chemat | 1g | 5613,20 Pln | |
| BLDpharm | 50mg | 830,84 Pln | |
| BLDpharm | 100mg | 1358,44 Pln | |
| BLDpharm | 250mg | 2252,56 Pln | |
| BLDpharm | 1g | 5956,82 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 2-3 tygodnie |
Tert-butyl 3-fluoro-3-(methylsulfonyloxymethyl)azetidine-1-carboxylate (CAS 1466514-75-9) to związek chemiczny o wzorze sumarycznym C10H18FNO5S i masie molowej 283.32 g/mol. Nazwa systematyczna IUPAC: tert-butyl 3-fluoro-3-(methylsulfonyloxymethyl)azetidine-1-carboxylate. InChIKey: ZPENGCVMSASEGY-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H18FNO5S |
|---|---|
| Masa molowa | 283.32 g/mol |
| Nazwa IUPAC | tert-butyl 3-fluoro-3-(methylsulfonyloxymethyl)azetidine-1-carboxylate |
| InChIKey | ZPENGCVMSASEGY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(COS(=O)(=O)C)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
tert-Butyl 3-fluoro-3-(((methylsulfonyl)oxy)methyl)azetidine-1-carboxylate, tert-butyl 3-fluoro-3-[(methanesulfonyloxy)methyl]azetidine-1-carboxylate, tert-butyl 3-fluoro-3-(methylsulfonyloxymethyl)azetidine-1-carboxylate, tert-Butyl3-fluoro-3-(((methylsulfonyl)oxy)methyl)azetidine-1-carboxylate