cas: 193537-11-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl 4-(1-cyano-2-ethoxy-2-oxoethylidene)piperidine-1-carboxylate, 95%, 95% (CAS 193537-11-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11ANHS-100mg |
| cas | 193537-11-0 |
| opakowanie | 100mg |
| dostępność | 7.75g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 160,40 Pln | |
| Chemat | 250mg | 227,60 Pln | |
| Chemat | 500mg | 304,40 Pln | |
| Chemat | 1g | 477,20 Pln | |
| Chemat | 5g | 1442,00 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl 4-(1-cyano-2-ethoxy-2-oxoethylidene)piperidine-1-carboxylate (CAS 193537-11-0) to związek chemiczny o wzorze sumarycznym C15H22N2O4 i masie molowej 294.35 g/mol. Nazwa systematyczna IUPAC: tert-butyl 4-(1-cyano-2-ethoxy-2-oxoethylidene)piperidine-1-carboxylate. InChIKey: FYSWQLWLYPQLMR-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H22N2O4 |
|---|---|
| Masa molowa | 294.35 g/mol |
| Nazwa IUPAC | tert-butyl 4-(1-cyano-2-ethoxy-2-oxoethylidene)piperidine-1-carboxylate |
| InChIKey | FYSWQLWLYPQLMR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C1CCN(CC1)C(=O)OC(C)(C)C)C#N |
Dane obliczone przez PubChem (NCBI)