cas: 1211582-61-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate, 97%, 97% (CAS 1211582-61-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch110WHO-100mg |
| cas | 1211582-61-4 |
| opakowanie | 100mg |
| dostępność | 75g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 170,00 Pln | |
| Chemat | 250mg | 251,60 Pln | |
| Chemat | 500mg | 290,00 Pln | |
| Chemat | 1g | 381,20 Pln | |
| Chemat | 5g | 1269,20 Pln | |
| Chemat | 10g | 2118,80 Pln | |
| Chemat | 25g | 4384,40 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate (CAS 1211582-61-4) to związek chemiczny o wzorze sumarycznym C11H19F3N2O2 i masie molowej 268.28 g/mol. Nazwa systematyczna IUPAC: tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: NYPUFDUCDMKIGM-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H19F3N2O2 |
|---|---|
| Masa molowa | 268.28 g/mol |
| Nazwa IUPAC | tert-butyl 4-amino-4-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | NYPUFDUCDMKIGM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C(F)(F)F)N |
Dane obliczone przez PubChem (NCBI)