tert-Butyl 5-aminopentanoate oxalate(1:x), 95%
cas: 660413-26-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl 5-aminopentanoate oxalate(1:x), 95% (CAS 660413-26-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 100mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A2258149-250mg |
| cas | 660413-26-3 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 309,19 Pln | |
| Ambeed | 1g | 709,69 Pln | |
| Ambeed | 5g | 1994,62 Pln | |
| Chemat | 100mg | 203,60 Pln | |
| Chemat | 250mg | 304,40 Pln | |
| Chemat | 1g | 707,60 Pln | |
| Chemat | 5g | 2003,60 Pln | |
| BLDpharm | 100mg | 219,95 Pln | |
| BLDpharm | 250mg | 325,47 Pln | |
| BLDpharm | 1g | 758,65 Pln | |
| BLDpharm | 5g | 2147,05 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
Tert-butyl 5-aminopentanoate;oxalic acid (CAS 660413-26-3) to związek chemiczny o wzorze sumarycznym C11H21NO6 i masie molowej 263.29 g/mol. Nazwa systematyczna IUPAC: tert-butyl 5-aminopentanoate;oxalic acid. InChIKey: ONEYSNZKNIVLPA-UHFFFAOYSA-N.
| Wzór sumaryczny | C11H21NO6 |
|---|---|
| Masa molowa | 263.29 g/mol |
| Nazwa IUPAC | tert-butyl 5-aminopentanoate;oxalic acid |
| InChIKey | ONEYSNZKNIVLPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCN.C(=O)(C(=O)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
tert-Butyl 5-aminopentanoate oxalate(1:x), ONEYSNZKNIVLPA-UHFFFAOYSA-N, tert-butyl 5-aminopentanoate oxalate, tert-Butyl 5-Aminopentanoate xOxalate, tert-butyl 5-aminopentanoate;oxalic acid, tert-butyl 5-aminopentanoate oxalic acid salt, Pentanoic acid, 5-amino-, 1,1-dimethylethyl ester, ethanedioate (1:)