tert-Butyl-4-aminophenylacetate 98%
cas: 174579-31-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-Butyl-4-aminophenylacetate 98% (CAS 174579-31-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A303988-100mg |
| cas | 174579-31-8 |
| opakowanie | 100mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 142,31 Pln | |
| Ambeed | 250mg | 192,38 Pln | |
| Ambeed | 1g | 214,62 Pln | |
| Ambeed | 5g | 659,62 Pln | |
| Ambeed | 10g | 1249,25 Pln | |
| Ambeed | 25g | 2439,62 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
| nr katalogowy ambeed | A303988 |
Tert-butyl 2-(4-aminophenyl)acetate (CAS 174579-31-8) to związek chemiczny o wzorze sumarycznym C12H17NO2 i masie molowej 207.27 g/mol. Nazwa systematyczna IUPAC: tert-butyl 2-(4-aminophenyl)acetate. InChIKey: OOPUFXZJWLZPLC-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H17NO2 |
|---|---|
| Masa molowa | 207.27 g/mol |
| Nazwa IUPAC | tert-butyl 2-(4-aminophenyl)acetate |
| InChIKey | OOPUFXZJWLZPLC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC=C(C=C1)N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
tert-butyl 2-(4-aminophenyl)acetate, tert-Butyl-4-aminophenylacetate, 4-Amino-benzeneacetic acid tert-butyl ester, tert-Butyl 4-aminophenylacetate, Benzeneacetic acid, 4-amino-, 1,1-dimethylethyl ester, 2-(4-aminophenyl)-3,3-dimethylbutanoate, 2-(4-Aminophenyl)acetic acid tert-butyl ester, orb3176390, tert.butyl 4-aminophenylacetate, OOPUFXZJWLZPLC-UHFFFAOYSA-N