cas: 1801243-43-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-butyl 3-[(3,5-dimethoxyphenyl)methylene]azetidine-1-carboxylate, 97% (CAS 1801243-43-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 500mg, 1g, 5g, 10g. Oferty producentów: Chemat, Fluorochem.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch135TKR-250mg |
| cas | 1801243-43-5 |
| opakowanie | 250mg |
| dostępność | 10g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 674,00 Pln | |
| Chemat | 500mg | 1072,40 Pln | |
| Chemat | 1g | 1595,60 Pln | |
| Chemat | 5g | 4811,60 Pln | |
| Chemat | 10g | 8133,20 Pln | |
| Fluorochem | 250mg | 1242,29 Pln | |
| Fluorochem | 500mg | 1981,61 Pln | |
| Fluorochem | 1g | 2965,64 Pln | |
| Fluorochem | 5g | 8765,68 Pln | |
| Fluorochem | 10g | 14846,87 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl 3-[(3,5-dimethoxyphenyl)methylidene]azetidine-1-carboxylate (CAS 1801243-43-5) to związek chemiczny o wzorze sumarycznym C17H23NO4 i masie molowej 305.4 g/mol. Nazwa systematyczna IUPAC: tert-butyl 3-[(3,5-dimethoxyphenyl)methylidene]azetidine-1-carboxylate. InChIKey: MFXOKRIDZSDTII-UHFFFAOYSA-N.
| Wzór sumaryczny | C17H23NO4 |
|---|---|
| Masa molowa | 305.4 g/mol |
| Nazwa IUPAC | tert-butyl 3-[(3,5-dimethoxyphenyl)methylidene]azetidine-1-carboxylate |
| InChIKey | MFXOKRIDZSDTII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=CC2=CC(=CC(=C2)OC)OC)C1 |
Dane obliczone przez PubChem (NCBI)