cas: 1048970-17-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate, 97%, 97% (CAS 1048970-17-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1149CR-250mg |
| cas | 1048970-17-7 |
| opakowanie | 250mg |
| dostępność | 1000g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 88,40 Pln | |
| Chemat | 5g | 150,80 Pln | |
| Chemat | 10g | 198,80 Pln | |
| Chemat | 25g | 395,60 Pln | |
| Chemat | 50g | 712,40 Pln | |
| Chemat | 100g | 1322,00 Pln | |
| Chemat | 500g | 6062,40 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate (CAS 1048970-17-7) to związek chemiczny o wzorze sumarycznym C16H30BNO4 i masie molowej 311.2 g/mol. Nazwa systematyczna IUPAC: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate. InChIKey: IBLQMWKHENBVJE-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H30BNO4 |
|---|---|
| Masa molowa | 311.2 g/mol |
| Nazwa IUPAC | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine-1-carboxylate |
| InChIKey | IBLQMWKHENBVJE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCN(CC2)C(=O)OC(C)(C)C |
Dane obliczone przez PubChem (NCBI)