trans,trans-4-Butyl-4'-(3,4-difluorophenyl)-1,1'-bi(cyclohexane), 98%
cas: 82832-58-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
trans,trans-4-Butyl-4'-(3,4-difluorophenyl)-1,1'-bi(cyclohexane), 98% (CAS 82832-58-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 10g, 25g, 100g, 1g. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A153758-5g |
| cas | 82832-58-4 |
| opakowanie | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 5g | 175,69 Pln | |
| Ambeed | 10g | 197,94 Pln | |
| Ambeed | 25g | 225,75 Pln | |
| Ambeed | 100g | 398,19 Pln | |
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 83,60 Pln | |
| Chemat | 10g | 93,20 Pln | |
| Chemat | 25g | 131,60 Pln | |
| BLDpharm | 5g | 186,63 Pln | |
| BLDpharm | 10g | 208,84 Pln | |
| BLDpharm | 25g | 236,61 Pln | |
| BLDpharm | 100g | 392,11 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie |
4-[4-(4-butylcyclohexyl)cyclohexyl]-1,2-difluorobenzene (CAS 82832-58-4) to związek chemiczny o wzorze sumarycznym C22H32F2 i masie molowej 334.5 g/mol. Nazwa systematyczna IUPAC: 4-[4-(4-butylcyclohexyl)cyclohexyl]-1,2-difluorobenzene. InChIKey: NZXZINXFUSKTPH-UHFFFAOYSA-N.
| Wzór sumaryczny | C22H32F2 |
|---|---|
| Masa molowa | 334.5 g/mol |
| Nazwa IUPAC | 4-[4-(4-butylcyclohexyl)cyclohexyl]-1,2-difluorobenzene |
| InChIKey | NZXZINXFUSKTPH-UHFFFAOYSA-N |
| SMILES | CCCCC1CCC(CC1)C2CCC(CC2)C3=CC(=C(C=C3)F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
trans,trans-4-Butyl-4'-(3,4-difluorophenyl)-1,1'-bi(cyclohexane), trans,trans-4-(3,4-Difluorophenyl)-4'-butyl-bicyclohexyl, 4-[4-(4-butylcyclohexyl)cyclohexyl]-1,2-difluorobenzene, 4-[4-(4-butylcyclohexyl)cyclohexyl]-1,2-difluoro-benzene, trans,trans-4'-Butyl-4-(3,4-difluorophenyl)bicyclohexyl, Benzene,4-[(trans,trans)-4'-butyl[1,1'-bicyclohexyl]-4-yl]-1,2-difluoro-, trans,trans-4-n-Butyl-4'-(3,4-difluorophenyl)bicyclohexyl, Oleylstearate, NZXZINXFUSKTPH-UHFFFAOYSA-N, 4bcHdFP