trans–Resveratrol–d4
cas: 1089051-56-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
trans–Resveratrol–d4 (CAS 1089051-56-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 100μg, 250μg, 500μg. Oferty producentów: GLPBio.
| producent | GLPBio |
|---|---|
| nr katalogowy | GC48194-1 |
| cas | 1089051-56-8 |
| opakowanie | 1mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| GLPBio | 1mg | 2918,57 Pln | |
| GLPBio | 100μg | 728,09 Pln | |
| GLPBio | 250μg | 1163,38 Pln | |
| GLPBio | 500μg | 1828,01 Pln |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | Do potwierdzenia przez Chemat |
5-[(E)-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethenyl]benzene-1,3-diol (CAS 1089051-56-8) to związek chemiczny o wzorze sumarycznym C14H12O3 i masie molowej 232.27 g/mol. Nazwa systematyczna IUPAC: 5-[(E)-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethenyl]benzene-1,3-diol. InChIKey: LUKBXSAWLPMMSZ-RRQWMZAJSA-N.
| Wzór sumaryczny | C14H12O3 |
|---|---|
| Masa molowa | 232.27 g/mol |
| Nazwa IUPAC | 5-[(E)-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| InChIKey | LUKBXSAWLPMMSZ-RRQWMZAJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1/C=C/C2=CC(=CC(=C2)O)O)[2H])[2H])O)[2H] |
Dane obliczone przez PubChem (NCBI)
Synonimy:
trans-Resveratrol-d4, Resveratrol-d4, trans/cis Resveratrol-D4, 5-[(E)-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)ethenyl]benzene-1,3-diol, Resveratrol-d, (E)-Resveratrol-d4, orb3138678, 5-[(1E)-2-[4-hydroxy(2,3,5,6-?H?)phenyl]ethenyl]benzene-1,3-diol, 5-[(E)-2-(2,3,5,6-tetradeuterio-4-hydroxy-phenyl)vinyl]benzene-1,3-diol