trans-Resveratrol 3,5-diacetate
cas: 411233-14-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
trans-Resveratrol 3,5-diacetate (CAS 411233-14-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 1g, 250mg, 500mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | CM53670C-100mg |
| cas | 411233-14-2 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 1483,35 Pln | |
| Chemat | 1g | 6824,41 Pln | |
| Chemat | 250mg | 2571,80 Pln | |
| Chemat | 500mg | 4104,16 Pln |
właściwości
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | no data |
| kategoria | Chemicals |
[3-acetyloxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] acetate (CAS 411233-14-2) to związek chemiczny o wzorze sumarycznym C18H16O5 i masie molowej 312.3 g/mol. Nazwa systematyczna IUPAC: [3-acetyloxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] acetate. InChIKey: YBTSXNIAKDYGPK-ONEGZZNKSA-N.
| Wzór sumaryczny | C18H16O5 |
|---|---|
| Masa molowa | 312.3 g/mol |
| Nazwa IUPAC | [3-acetyloxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] acetate |
| InChIKey | YBTSXNIAKDYGPK-ONEGZZNKSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)/C=C/C2=CC=C(C=C2)O)OC(=O)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Resveratrol-3,5-diacetate, Resveratrol 3,5-diacetate, (E)-5-(4-hydroxystyryl)-1,3-phenylene diacetate, [3-acetyloxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] acetate, 3,5-Di-O-acetylresveratrol, 1,3-Benzenediol, 5-[(1E)-2-(4-hydroxyphenyl)ethenyl]-, 1,3-diacetate, (e)-3-acetoxy-5-(4-hydroxystyryl)-phenyl acetate, [3-acetoxy-5-[(E)-2-(4-hydroxyphenyl)vinyl]phenyl] acetate, [3-acetyloxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl] ethanoate, 5-[(E)-2-(4-Hydroxyphenyl)ethen-1-yl]-1,3-phenylene diacetate