cas: 1146188-19-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(2-Amino-4-(3,5-bis(trifluoromethyl)phenyl)thiophen-3-yl)(4-chlorophenyl)methanone, 97%, 97% (CAS 1146188-19-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch134JLF-2mg |
| cas | 1146188-19-3 |
| opakowanie | 2mg |
| dostępność | 0.5g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 2mg | 410,00 Pln | |
| Chemat | 5mg | 558,80 Pln | |
| Chemat | 10mg | 842,00 Pln | |
| Chemat | 25mg | 1422,80 Pln | |
| Chemat | 50mg | 2459,60 Pln | |
| Chemat | 100mg | 3822,80 Pln | |
| Chemat | 250mg | 5699,60 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
[2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone (CAS 1146188-19-3) to związek chemiczny o wzorze sumarycznym C19H10ClF6NOS i masie molowej 449.8 g/mol. Nazwa systematyczna IUPAC: [2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone. InChIKey: IVHJBJJHYFIUOA-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H10ClF6NOS |
|---|---|
| Masa molowa | 449.8 g/mol |
| Nazwa IUPAC | [2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
| InChIKey | IVHJBJJHYFIUOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(SC=C2C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)N)Cl |
Dane obliczone przez PubChem (NCBI)