cas: 1146188-19-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
MIPS521, 98.21% (CAS 1146188-19-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 5 mg, 100 mg, 50 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-139644-10 mg |
| cas | 1146188-19-3 |
| opakowanie | 10 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 793,38 Pln | |
| MedChemExpress | 5 mg | 551,89 Pln | |
| MedChemExpress | 100 mg | 3236,12 Pln | |
| MedChemExpress | 50 mg | 2135,50 Pln | |
| MedChemExpress | 10mM/1mL | 593,69 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.21% |
[2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone (CAS 1146188-19-3) to związek chemiczny o wzorze sumarycznym C19H10ClF6NOS i masie molowej 449.8 g/mol. Nazwa systematyczna IUPAC: [2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone. InChIKey: IVHJBJJHYFIUOA-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H10ClF6NOS |
|---|---|
| Masa molowa | 449.8 g/mol |
| Nazwa IUPAC | [2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
| InChIKey | IVHJBJJHYFIUOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(SC=C2C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)N)Cl |
Dane obliczone przez PubChem (NCBI)