(3-(Trifluoromethoxy)phenyl)boronic acid, 98%
cas: 179113-90-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(3-(Trifluoromethoxy)phenyl)boronic acid, 98% (CAS 179113-90-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 100g, 500g. Oferty producentów: Chemat, BLDpharm.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1137SM-1g |
| cas | 179113-90-7 |
| opakowanie | 1g |
| dostępność | 200g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 83,60 Pln | |
| Chemat | 5g | 107,60 Pln | |
| Chemat | 10g | 146,00 Pln | |
| Chemat | 25g | 270,80 Pln | |
| Chemat | 100g | 856,40 Pln | |
| BLDpharm | 1g | 186,63 Pln | |
| BLDpharm | 5g | 214,39 Pln | |
| BLDpharm | 10g | 258,82 Pln | |
| BLDpharm | 25g | 430,98 Pln | |
| BLDpharm | 100g | 1219,60 Pln | |
| BLDpharm | 500g | 4657,27 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
[3-(trifluoromethoxy)phenyl]boronic acid (CAS 179113-90-7) to związek chemiczny o wzorze sumarycznym C7H6BF3O3 i masie molowej 205.93 g/mol. Nazwa systematyczna IUPAC: [3-(trifluoromethoxy)phenyl]boronic acid. InChIKey: UWDFWVLAHRQSKK-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H6BF3O3 |
|---|---|
| Masa molowa | 205.93 g/mol |
| Nazwa IUPAC | [3-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | UWDFWVLAHRQSKK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OC(F)(F)F)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3-(Trifluoromethoxy)phenylboronic acid (contains varying amounts of Anhydride), 3-(Trifluoromethoxy)phenylboronic acid, 3-Trifluoromethoxyphenylboronic acid, (3-(Trifluoromethoxy)phenyl)boronic acid, [3-(trifluoromethoxy)phenyl]boronic Acid, 3-(Trifluoromethoxy)benzeneboronic Acid, Boronic acid, B-[3-(trifluoromethoxy)phenyl]-, Boronic acid, [3-(trifluoromethoxy)phenyl]-, 3-(trifluoromethoxy)phenyl boronic acid, 3-trifluoromethoxybenzene boronic acid
