Produkty 175676-65-0
CAS 175676-65-0 występuje w naszej ofercie pod nazwami: 2–(Trifluoromethoxy)phenylboronic acid, 2-(Trifluoromethoxy)phenylboronic acid, 2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride), 2-Trifluoromethoxyphenylboronic acid, 97%, 2-Trifluoromethoxyphenylboronic acid 97%. Oferty producentów: GLPBio, Biosynth, TCI, Thermo Scientific (Acros), Ambeed. Dostępne opakowania: 100g, 25g, 10g, 5g, 1g, 50g, 500g.
[2-(trifluoromethoxy)phenyl]boronic acid (CAS 175676-65-0) to związek chemiczny o wzorze sumarycznym C7H6BF3O3 i masie molowej 205.93 g/mol. Nazwa systematyczna IUPAC: [2-(trifluoromethoxy)phenyl]boronic acid. InChIKey: AIJCNTOYZPKURP-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H6BF3O3 |
|---|---|
| Masa molowa | 205.93 g/mol |
| Nazwa IUPAC | [2-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | AIJCNTOYZPKURP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OC(F)(F)F)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride), 2-(Trifluoromethoxy)phenylboronic acid, 2-Trifluoromethoxyphenylboronic acid, 2-(Trifluoromethoxy)benzeneboronic Acid, 2-(Trifluormethoxy)phenylboronic acid, [2-(trifluoromethoxy)phenyl]boronic Acid, (2-(trifluoromethoxy)phenyl)boronic acid, 2-Trifluormethoxyphenylboronic acid, Boronic acid, [2-(trifluoromethoxy)phenyl]-, Boronic acid, B-[2-(trifluoromethoxy)phenyl]-