(S)-(-)-1,1,2-Triphenyl-1,2-ethanediol
cas: 108998-83-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-(-)-1,1,2-Triphenyl-1,2-ethanediol (CAS 108998-83-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 2g, 1g, 10g, 25g. Oferty producentów: Biosynth, TCI.
| producent | Biosynth |
|---|---|
| nr katalogowy | IT58096-5g |
| cas | 108998-83-0 |
| opakowanie | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Biosynth | 5g | cena na żądanie | |
| Biosynth | 2g | cena na żądanie | |
| TCI | 1g | 256,03 Pln | |
| Biosynth | 10g | cena na żądanie | |
| Biosynth | 25g | cena na żądanie |
właściwości
| kategoria | Impurities |
|---|---|
| podkategoria 1 | Esomeprazole |
| czystość | No data |
| czas dostawy | 3-4 tygodnie |
(2S)-1,1,2-triphenylethane-1,2-diol (CAS 108998-83-0) to związek chemiczny o wzorze sumarycznym C20H18O2 i masie molowej 290.4 g/mol. Nazwa systematyczna IUPAC: (2S)-1,1,2-triphenylethane-1,2-diol. InChIKey: GWVWUZJOQHWMFB-IBGZPJMESA-N.
| Wzór sumaryczny | C20H18O2 |
|---|---|
| Masa molowa | 290.4 g/mol |
| Nazwa IUPAC | (2S)-1,1,2-triphenylethane-1,2-diol |
| InChIKey | GWVWUZJOQHWMFB-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(C2=CC=CC=C2)(C3=CC=CC=C3)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2S)-1,1,2-triphenylethane-1,2-diol, (2S)-1,1,2-Triphenyl-1,2-ethanediol, (S)-(-)-1,1,2-Triphenylethane-1,2-diol, (S)-1,1,2-Triphenyl-1,2-ethanediol, (S)-1,1,2-Triphenylethane-1,2-diol, (S)-(-)-1,1,2-Triphenyl-1,2-ethanediol, 1,2-Ethanediol, 1,1,2-triphenyl-, (2S)-, (S)-triphenyl-ethane-1,2-diol, (S)-(-)-Triphenylethylene Glycol, (S)-2,2,1-Triphenyl-ethane-1,2-diol