(S)-1,1,2-Triphenyl-1,2-ethanediol, 98%, 98%
cas: 108998-83-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
(S)-1,1,2-Triphenyl-1,2-ethanediol, 98%, 98% (CAS 108998-83-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch118BJJ-250mg |
| cas | 108998-83-0 |
| opakowanie | 250mg |
| dostępność | 50g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 78,80 Pln | |
| Chemat | 1g | 102,80 Pln | |
| Chemat | 5g | 213,20 Pln | |
| Chemat | 10g | 338,00 Pln | |
| Chemat | 25g | 573,20 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S)-1,1,2-triphenylethane-1,2-diol (CAS 108998-83-0) to związek chemiczny o wzorze sumarycznym C20H18O2 i masie molowej 290.4 g/mol. Nazwa systematyczna IUPAC: (2S)-1,1,2-triphenylethane-1,2-diol. InChIKey: GWVWUZJOQHWMFB-IBGZPJMESA-N.
| Wzór sumaryczny | C20H18O2 |
|---|---|
| Masa molowa | 290.4 g/mol |
| Nazwa IUPAC | (2S)-1,1,2-triphenylethane-1,2-diol |
| InChIKey | GWVWUZJOQHWMFB-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(C2=CC=CC=C2)(C3=CC=CC=C3)O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(2S)-1,1,2-triphenylethane-1,2-diol, (2S)-1,1,2-Triphenyl-1,2-ethanediol, (S)-(-)-1,1,2-Triphenylethane-1,2-diol, (S)-1,1,2-Triphenyl-1,2-ethanediol, (S)-1,1,2-Triphenylethane-1,2-diol, (S)-(-)-1,1,2-Triphenyl-1,2-ethanediol, 1,2-Ethanediol, 1,1,2-triphenyl-, (2S)-, (S)-triphenyl-ethane-1,2-diol, (S)-(-)-Triphenylethylene Glycol, (S)-2,2,1-Triphenyl-ethane-1,2-diol