1-([1,1'-Biphenyl]-4-ylmethyl)-5-(trifluoromethoxy)indoline-2,3-dione, 98%, 98%
cas: 1208222-39-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
1-([1,1'-Biphenyl]-4-ylmethyl)-5-(trifluoromethoxy)indoline-2,3-dione, 98%, 98% (CAS 1208222-39-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25mg, 50mg, 100mg, 250mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119VNP-25mg |
| cas | 1208222-39-2 |
| opakowanie | 25mg |
| dostępność | 0.5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 25mg | 405,20 Pln | |
| Chemat | 50mg | 650,00 Pln | |
| Chemat | 100mg | 1058,00 Pln | |
| Chemat | 250mg | 2128,40 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione (CAS 1208222-39-2) to związek chemiczny o wzorze sumarycznym C22H14F3NO3 i masie molowej 397.3 g/mol. Nazwa systematyczna IUPAC: 1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione. InChIKey: SPBGRXOPAXZSER-UHFFFAOYSA-N.
| Wzór sumaryczny | C22H14F3NO3 |
|---|---|
| Masa molowa | 397.3 g/mol |
| Nazwa IUPAC | 1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione |
| InChIKey | SPBGRXOPAXZSER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CN3C4=C(C=C(C=C4)OC(F)(F)F)C(=O)C3=O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1-([1,1'-Biphenyl]-4-ylmethyl)-5-(trifluoromethoxy)indoline-2,3-dione, vu0365114, 1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione, 1-Biphenyl-4-ylmethyl-5-trifluoromethoxy-1H-indole-2,3-dione, 1-[(1,1'-Biphenyl)-4-ylmethyl]-5-(trifluoromethoxy)-1H-indole-2,3-dione, 1-(biphenyl-4-ylmethyl)-5-(trifluoromethoxy)indoline-2,3-dione, orb1308943, cid_45281794, 1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indoline-2,3-dione, 1H-Indole-2,3-dione, 1-([1,1'-biphenyl]-4-ylmethyl)-5-(trifluoromethoxy)-