VU 0365114
cas: 1208222-39-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
VU 0365114 (CAS 1208222-39-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg, 1mg. Oferty producentów: TRC, TargetMol, GLPBio, Biosynth.
| producent | TRC |
|---|---|
| nr katalogowy | TRC-V787560-100MG |
| cas | 1208222-39-2 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| TRC | 100mg | cena na żądanie | |
| TargetMol | 2mg | 399,00 Pln | |
| TargetMol | 5mg | 532,05 Pln | |
| TargetMol | 10mg | 671,24 Pln | |
| TargetMol | 25mg | 1076,51 Pln | |
| TargetMol | 50mg | 1680,79 Pln | |
| TargetMol | 100mg | 2424,82 Pln | |
| TargetMol | 200mg | 3308,04 Pln | |
| GLPBio | 1mg | 583,00 Pln | |
| GLPBio | 10mg | 1004,24 Pln | |
| GLPBio | 100mg | 2562,85 Pln | |
| GLPBio | 5mg | 793,62 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 831,06 Pln | |
| GLPBio | 50mg | 1804,61 Pln | |
| Biosynth | 100mg | cena na żądanie |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | Do potwierdzenia przez Chemat |
1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione (CAS 1208222-39-2) to związek chemiczny o wzorze sumarycznym C22H14F3NO3 i masie molowej 397.3 g/mol. Nazwa systematyczna IUPAC: 1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione. InChIKey: SPBGRXOPAXZSER-UHFFFAOYSA-N.
| Wzór sumaryczny | C22H14F3NO3 |
|---|---|
| Masa molowa | 397.3 g/mol |
| Nazwa IUPAC | 1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione |
| InChIKey | SPBGRXOPAXZSER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CN3C4=C(C=C(C=C4)OC(F)(F)F)C(=O)C3=O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1-([1,1'-Biphenyl]-4-ylmethyl)-5-(trifluoromethoxy)indoline-2,3-dione, vu0365114, 1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indole-2,3-dione, 1-Biphenyl-4-ylmethyl-5-trifluoromethoxy-1H-indole-2,3-dione, 1-[(1,1'-Biphenyl)-4-ylmethyl]-5-(trifluoromethoxy)-1H-indole-2,3-dione, 1-(biphenyl-4-ylmethyl)-5-(trifluoromethoxy)indoline-2,3-dione, orb1308943, cid_45281794, 1-[(4-phenylphenyl)methyl]-5-(trifluoromethoxy)indoline-2,3-dione, 1H-Indole-2,3-dione, 1-([1,1'-biphenyl]-4-ylmethyl)-5-(trifluoromethoxy)-