2,2'-Thenil 98%
cas: 7333-07-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,2'-Thenil 98% (CAS 7333-07-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A856495-250mg |
| cas | 7333-07-5 |
| opakowanie | 250mg |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 270,25 Pln | |
| Ambeed | 1g | 464,94 Pln | |
| Ambeed | 5g | 1616,38 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 2-3 tygodnie |
| nr katalogowy ambeed | A856495 |
1,2-dithiophen-2-ylethane-1,2-dione (CAS 7333-07-5) to związek chemiczny o wzorze sumarycznym C10H6O2S2 i masie molowej 222.3 g/mol. Nazwa systematyczna IUPAC: 1,2-dithiophen-2-ylethane-1,2-dione. InChIKey: UNWKVSDABPCZMK-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H6O2S2 |
|---|---|
| Masa molowa | 222.3 g/mol |
| Nazwa IUPAC | 1,2-dithiophen-2-ylethane-1,2-dione |
| InChIKey | UNWKVSDABPCZMK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C(=O)C2=CC=CS2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,2'-Thenil, 1,2-di(thiophen-2-yl)ethane-1,2-dione, 1,2-dithiophen-2-ylethane-1,2-dione, bis(thiophen-2-yl)ethane-1,2-dione, 1,2-di(2-thienyl)-1,2-ethanedione, 1,2-Di-thiophen-2-yl-ethane-1,2-dione, 1,2-di(2-thienyl)ethane-1,2-dione, 2,2 inverted exclamation marka-Thenil, Ethanedione, di-2-thienyl-, Di-2-thienylethanedione