2,3,4,5,6-Pentafluorostyrene 98% (stabilized with TBC)
cas: 653-34-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
2,3,4,5,6-Pentafluorostyrene 98% (stabilized with TBC) (CAS 653-34-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 25g, 100g, 500g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A519563-1g |
| cas | 653-34-9 |
| opakowanie | 1g |
Dokumenty:
Karta charakterystyki (MSDS)
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1g | 120,06 Pln | |
| Ambeed | 5g | 248,00 Pln | |
| Ambeed | 25g | 926,62 Pln | |
| Ambeed | 100g | 2817,88 Pln | |
| Ambeed | 500g | 11067,06 Pln |
właściwości
| czystość | 98% (stabilized with TBC) |
|---|---|
| czas dostawy | 1-2 tygodnie |
| nr katalogowy ambeed | A519563 |
1-ethenyl-2,3,4,5,6-pentafluorobenzene (CAS 653-34-9) to związek chemiczny o wzorze sumarycznym C8H3F5 i masie molowej 194.10 g/mol. Nazwa systematyczna IUPAC: 1-ethenyl-2,3,4,5,6-pentafluorobenzene. InChIKey: LVJZCPNIJXVIAT-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H3F5 |
|---|---|
| Masa molowa | 194.10 g/mol |
| Nazwa IUPAC | 1-ethenyl-2,3,4,5,6-pentafluorobenzene |
| InChIKey | LVJZCPNIJXVIAT-UHFFFAOYSA-N |
| SMILES | C=CC1=C(C(=C(C(=C1F)F)F)F)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,3,4,5,6-Pentafluorostyrene, 1-ethenyl-2,3,4,5,6-pentafluorobenzene, Benzene, ethenylpentafluoro-, Vinylpentafluorobenzene, Styrene, 2,3,4,5,6-pentafluoro-, LVJZCPNIJXVIAT-UHFFFAOYSA-N, Pentafluorostyrene, 1,2,3,4,5-Pentafluoro-6-vinylbenzene, 1,2,3,4,5-pentafluoro-6-vinyl-benzene, 2,3,4,5,6-Pentafluorostyrene (stabilized with TBC)