CAS 653-34-9 występuje w naszej ofercie pod nazwami: 2,3,4,5,6-Pentafluorostyrene, 95%, 2,3,4,5,6–Pentafluorostyrene (stabilized with TBC), 2,3,4,5,6-Pentafluorostyrene, 98%, stab. with 250ppm 4-tert-, 2,3,4,5,6-Pentafluorostyrene, 2,3,4,5,6-Pentafluorostyrene (stabilized with TBC), >98.0%(GC). Oferty producentów: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Dostępne opakowania: 1g, 100g, 25g, 5g, 10g, 50g, 1000g, 500g.
1-ethenyl-2,3,4,5,6-pentafluorobenzene (CAS 653-34-9) to związek chemiczny o wzorze sumarycznym C8H3F5 i masie molowej 194.10 g/mol. Nazwa systematyczna IUPAC: 1-ethenyl-2,3,4,5,6-pentafluorobenzene. InChIKey: LVJZCPNIJXVIAT-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H3F5 |
|---|---|
| Masa molowa | 194.10 g/mol |
| Nazwa IUPAC | 1-ethenyl-2,3,4,5,6-pentafluorobenzene |
| InChIKey | LVJZCPNIJXVIAT-UHFFFAOYSA-N |
| SMILES | C=CC1=C(C(=C(C(=C1F)F)F)F)F |
Dane obliczone przez PubChem (NCBI)