Produkty 178752-79-9
CAS 178752-79-9 występuje w naszej ofercie pod nazwami: 3-(N,N-Dimethylamino)phenylboronic Acid, 3–(N,N–Dimethylamino)phenylboronic Acid(contains varying amounts of Anhydride), 3-(N,N-Dimethylamino)phenylboronic acid/ 95+%, 3-(N,N-Dimethylamino)phenylboronic acid 96%, 3-(Dimethylamino)phenylboronic acid, 95%. Oferty producentów: TRC, GLPBio, Chemat, Ambeed, Fluorochem. Dostępne opakowania: 1g, 25g, 5g, 100g, 250mg, 10g.
[3-(dimethylamino)phenyl]boronic acid (CAS 178752-79-9) to związek chemiczny o wzorze sumarycznym C8H12BNO2 i masie molowej 165.00 g/mol. Nazwa systematyczna IUPAC: [3-(dimethylamino)phenyl]boronic acid. InChIKey: YZQQHZXHCXAJAV-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H12BNO2 |
|---|---|
| Masa molowa | 165.00 g/mol |
| Nazwa IUPAC | [3-(dimethylamino)phenyl]boronic acid |
| InChIKey | YZQQHZXHCXAJAV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N(C)C)(O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3-(Dimethylamino)benzeneboronic acid, 3-(N,N-Dimethylamino)phenylboronic acid, 3-Dimethylaminophenylboronic acid, (3-(dimethylamino)phenyl)boronic acid, [3-(dimethylamino)phenyl]boronic acid, 3-(dimethylamino)phenylboronic acid, Boronic acid, B-[3-(dimethylamino)phenyl]-, 3-dimethylaminophenyl boronic acid, 3-(dimethylamino) phenylboronic acid, 3-(dimethylamino)phenyl boronic acid