4,4'-(Ethene-1,2-diyl)dibenzoic acid, 97%
cas: 100-31-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4'-(Ethene-1,2-diyl)dibenzoic acid, 97% (CAS 100-31-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 10g, 25g, 50g, 75g, 100g, 250g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11117L-5g |
| cas | 100-31-2 |
| opakowanie | 5g |
| dostępność | 250g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 5g | 83,60 Pln | |
| Chemat | 10g | 102,80 Pln | |
| Chemat | 25g | 107,60 Pln | |
| Chemat | 50g | 146,00 Pln | |
| Chemat | 75g | 184,40 Pln | |
| Chemat | 100g | 218,00 Pln | |
| Chemat | 250g | 438,80 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid (CAS 100-31-2) to związek chemiczny o wzorze sumarycznym C16H12O4 i masie molowej 268.26 g/mol. Nazwa systematyczna IUPAC: 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid. InChIKey: SBBQDUFLZGOASY-OWOJBTEDSA-N.
| Wzór sumaryczny | C16H12O4 |
|---|---|
| Masa molowa | 268.26 g/mol |
| Nazwa IUPAC | 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid |
| InChIKey | SBBQDUFLZGOASY-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)C(=O)O)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(E)-4,4'-(ethene-1,2-diyl)dibenzoic acid, Stilbene-4,4'-dicarboxylic acid, 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid, Benzoic acid, 4,4'-(1,2-ethenediyl)bis-, 4,4'-(Ethene-1,2-diyl)dibenzoic acid, Benzoic acid, 4,4'-(1E)-1,2-ethenediylbis-, 4-[(1E)-2-(4-carboxyphenyl)vinyl]benzoic acid, Benzoic acid, 4,4'-(1Z)-1,2-ethenediylbis-, 4-[(1Z)-2-(4-carboxyphenyl)ethenyl]benzoic acid, 4,4-Stilbenedicarboxylic Acid