4,4'-Stilbenedicarboxylic acid, 95%
cas: 100-31-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4'-Stilbenedicarboxylic acid, 95% (CAS 100-31-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 100g, 500g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A705140-1g |
| cas | 100-31-2 |
| opakowanie | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 1g | 175,69 Pln | |
| Ambeed | 5g | 197,94 Pln | |
| Ambeed | 10g | 225,75 Pln | |
| Ambeed | 25g | 337,00 Pln | |
| Ambeed | 100g | 592,88 Pln | |
| Ambeed | 500g | 2167,06 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid (CAS 100-31-2) to związek chemiczny o wzorze sumarycznym C16H12O4 i masie molowej 268.26 g/mol. Nazwa systematyczna IUPAC: 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid. InChIKey: SBBQDUFLZGOASY-OWOJBTEDSA-N.
| Wzór sumaryczny | C16H12O4 |
|---|---|
| Masa molowa | 268.26 g/mol |
| Nazwa IUPAC | 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid |
| InChIKey | SBBQDUFLZGOASY-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)C(=O)O)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(E)-4,4'-(ethene-1,2-diyl)dibenzoic acid, Stilbene-4,4'-dicarboxylic acid, 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid, Benzoic acid, 4,4'-(1,2-ethenediyl)bis-, 4,4'-(Ethene-1,2-diyl)dibenzoic acid, Benzoic acid, 4,4'-(1E)-1,2-ethenediylbis-, 4-[(1E)-2-(4-carboxyphenyl)vinyl]benzoic acid, Benzoic acid, 4,4'-(1Z)-1,2-ethenediylbis-, 4-[(1Z)-2-(4-carboxyphenyl)ethenyl]benzoic acid, 4,4-Stilbenedicarboxylic Acid