cas: 119586-44-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl, >98.0%(HPLC) (CAS 119586-44-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 200mg. Oferty producentów: TCI.
| producent | TCI |
|---|---|
| nr katalogowy | B4682-200MG |
| cas | 119586-44-6 |
| opakowanie | 200mg |
| dostępność | 2 tygodnie|2 weeks |
| producent | opakowanie | cena | |
|---|---|---|---|
| TCI | 200mg | 590,40 Pln |
| czas dostawy | 2 tygodnie |
|---|---|
| kategoria | chemicals |
| czystość | >98.0%(HPLC) |
4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline (CAS 119586-44-6) to związek chemiczny o wzorze sumarycznym C56H48N2 i masie molowej 749.0 g/mol. Nazwa systematyczna IUPAC: 4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline. InChIKey: OSQXTXTYKAEHQV-WXUKJITCSA-N.
| Wzór sumaryczny | C56H48N2 |
|---|---|
| Masa molowa | 749.0 g/mol |
| Nazwa IUPAC | 4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline |
| InChIKey | OSQXTXTYKAEHQV-WXUKJITCSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)/C=C/C3=CC=C(C=C3)C4=CC=C(C=C4)/C=C/C5=CC=C(C=C5)N(C6=CC=C(C=C6)C)C7=CC=C(C=C7)C)C8=CC=C(C=C8)C |
Dane obliczone przez PubChem (NCBI)