cas: 119586-44-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl (CAS 119586-44-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 1g, 250mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch111IZG-100mg |
| cas | 119586-44-6 |
| opakowanie | 100mg |
| dostępność | 6g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 261,20 Pln | |
| Chemat | 1g | 1096,40 Pln | |
| Chemat | 250mg | 405,20 Pln |
| czas dostawy | 3 tygodnie |
|---|
4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline (CAS 119586-44-6) to związek chemiczny o wzorze sumarycznym C56H48N2 i masie molowej 749.0 g/mol. Nazwa systematyczna IUPAC: 4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline. InChIKey: OSQXTXTYKAEHQV-WXUKJITCSA-N.
| Wzór sumaryczny | C56H48N2 |
|---|---|
| Masa molowa | 749.0 g/mol |
| Nazwa IUPAC | 4-methyl-N-[4-[(E)-2-[4-[4-[(E)-2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-N-(4-methylphenyl)aniline |
| InChIKey | OSQXTXTYKAEHQV-WXUKJITCSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)/C=C/C3=CC=C(C=C3)C4=CC=C(C=C4)/C=C/C5=CC=C(C=C5)N(C6=CC=C(C=C6)C)C7=CC=C(C=C7)C)C8=CC=C(C=C8)C |
Dane obliczone przez PubChem (NCBI)